Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Mercury(II) iodide, ACS reagent, Red
CAS: 7774-29-0 Molecular Formula: HgI2 Molecular Weight (g/mol): 454.39 InChI Key: YFDLHELOZYVNJE-UHFFFAOYSA-L Synonym: mercury diiodide,mercuric iodide,mercury ii iodide,red mercuric iodide,mercuric iodide, red,mercury biniodide,mercury iodide,mercurius bijodatus,hydrargyrum diodatum,hydrargyrum bijodatum PubChem CID: 24485 ChEBI: CHEBI:49659 IUPAC Name: diiodomercury SMILES: I[Hg]I
| PubChem CID | 24485 |
|---|---|
| CAS | 7774-29-0 |
| Molecular Weight (g/mol) | 454.39 |
| ChEBI | CHEBI:49659 |
| SMILES | I[Hg]I |
| Synonym | mercury diiodide,mercuric iodide,mercury ii iodide,red mercuric iodide,mercuric iodide, red,mercury biniodide,mercury iodide,mercurius bijodatus,hydrargyrum diodatum,hydrargyrum bijodatum |
| IUPAC Name | diiodomercury |
| InChI Key | YFDLHELOZYVNJE-UHFFFAOYSA-L |
| Molecular Formula | HgI2 |
Selenium, Black 99+, MilliporeSigma™
CAS: 7782-49-2 Molecular Formula: Se Molecular Weight (g/mol): 78.97 MDL Number: MFCD00134090 MFCD00011224 InChI Key: BUGBHKTXTAQXES-UHFFFAOYSA-N Synonym: selenium, elemental,selen,hydride,atom,elemental,selenio,vandex,alloy,and compounds,gray PubChem CID: 6326970 ChEBI: CHEBI:27568 IUPAC Name: selenium SMILES: [Se]
| PubChem CID | 6326970 |
|---|---|
| CAS | 7782-49-2 |
| Molecular Weight (g/mol) | 78.97 |
| ChEBI | CHEBI:27568 |
| MDL Number | MFCD00134090 MFCD00011224 |
| SMILES | [Se] |
| Synonym | selenium, elemental,selen,hydride,atom,elemental,selenio,vandex,alloy,and compounds,gray |
| IUPAC Name | selenium |
| InChI Key | BUGBHKTXTAQXES-UHFFFAOYSA-N |
| Molecular Formula | Se |
Chromium pieces, 1-25mm (0.04-1in), 99.99% (metals basis)
CAS: 7440-47-3 Molecular Formula: Cr Molecular Weight (g/mol): 52.00 MDL Number: MFCD00010944 InChI Key: VYZAMTAEIAYCRO-UHFFFAOYSA-N Synonym: chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 PubChem CID: 23976 ChEBI: CHEBI:28073 IUPAC Name: chromium SMILES: [Cr]
| PubChem CID | 23976 |
|---|---|
| CAS | 7440-47-3 |
| Molecular Weight (g/mol) | 52.00 |
| ChEBI | CHEBI:28073 |
| MDL Number | MFCD00010944 |
| SMILES | [Cr] |
| Synonym | chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 |
| IUPAC Name | chromium |
| InChI Key | VYZAMTAEIAYCRO-UHFFFAOYSA-N |
| Molecular Formula | Cr |
(Triethylsilyl)acetylene, 97%
CAS: 1777-03-3 Molecular Formula: C8H16Si Molecular Weight (g/mol): 140.30 MDL Number: MFCD00075373 InChI Key: FWSPXZXVNVQHIF-UHFFFAOYSA-N Synonym: triethylsilyl acetylene,ethynyltriethylsilane,triethyl ethynyl silane,triethylsilylacetylene,silane, triethylethynyl,triethylsilyl acetylen,triethylsilyl-acetylene,triethyl-ethynyl-silane PubChem CID: 637947 IUPAC Name: triethyl(ethynyl)silane SMILES: CC[Si](CC)(CC)C#C
| PubChem CID | 637947 |
|---|---|
| CAS | 1777-03-3 |
| Molecular Weight (g/mol) | 140.30 |
| MDL Number | MFCD00075373 |
| SMILES | CC[Si](CC)(CC)C#C |
| Synonym | triethylsilyl acetylene,ethynyltriethylsilane,triethyl ethynyl silane,triethylsilylacetylene,silane, triethylethynyl,triethylsilyl acetylen,triethylsilyl-acetylene,triethyl-ethynyl-silane |
| IUPAC Name | triethyl(ethynyl)silane |
| InChI Key | FWSPXZXVNVQHIF-UHFFFAOYSA-N |
| Molecular Formula | C8H16Si |
Lead(II,IV) oxide, red, 98%
CAS: 1314-41-6 Molecular Formula: O4Pb3 Molecular Weight (g/mol): 685.57 MDL Number: MFCD00078491 InChI Key: XMFOQHDPRMAJNU-UHFFFAOYSA-N Synonym: lead tetroxide,orange lead,lead oxide, red,lead ii,iv oxide,po4b3,lead oxide, red, lr,lead oxide, red powder, 1-2 mum,lead oxide, red, saj first grade,lead oxide, powder trace metals basis PubChem CID: 16685188 IUPAC Name: 1,3,5,7-tetraoxa-2$l^{2},4,6$l^{2}-triplumbaspiro[3.3]heptane SMILES: O1[Pb]O[Pb]12O[Pb]O2
| PubChem CID | 16685188 |
|---|---|
| CAS | 1314-41-6 |
| Molecular Weight (g/mol) | 685.57 |
| MDL Number | MFCD00078491 |
| SMILES | O1[Pb]O[Pb]12O[Pb]O2 |
| Synonym | lead tetroxide,orange lead,lead oxide, red,lead ii,iv oxide,po4b3,lead oxide, red, lr,lead oxide, red powder, 1-2 mum,lead oxide, red, saj first grade,lead oxide, powder trace metals basis |
| IUPAC Name | 1,3,5,7-tetraoxa-2$l^{2},4,6$l^{2}-triplumbaspiro[3.3]heptane |
| InChI Key | XMFOQHDPRMAJNU-UHFFFAOYSA-N |
| Molecular Formula | O4Pb3 |
Cadmium Carbonate, Pure
CAS: 513-78-0 Molecular Formula: CCdO3 Molecular Weight (g/mol): 172.42 MDL Number: MFCD00010918 InChI Key: GKDXQAKPHKQZSC-UHFFFAOYSA-L Synonym: cadmium carbonate,mikrokalcit,otavite,kalcit,supermikrokalcit,carbonic acid, cadmium salt 1:1,cadmium monocarbonate,chemcarb cdco3,caswell no. 134a,unii-616zvs3bly PubChem CID: 10564 IUPAC Name: cadmium(2+) carbonate SMILES: [Cd++].[O-]C([O-])=O
| PubChem CID | 10564 |
|---|---|
| CAS | 513-78-0 |
| Molecular Weight (g/mol) | 172.42 |
| MDL Number | MFCD00010918 |
| SMILES | [Cd++].[O-]C([O-])=O |
| Synonym | cadmium carbonate,mikrokalcit,otavite,kalcit,supermikrokalcit,carbonic acid, cadmium salt 1:1,cadmium monocarbonate,chemcarb cdco3,caswell no. 134a,unii-616zvs3bly |
| IUPAC Name | cadmium(2+) carbonate |
| InChI Key | GKDXQAKPHKQZSC-UHFFFAOYSA-L |
| Molecular Formula | CCdO3 |
Palladium, 5% on carbon powder, Type 490
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
tert-Butyldimethylsilylacetylene, 98%
CAS: 86318-61-8 Molecular Formula: C8H16Si Molecular Weight (g/mol): 140.301 MDL Number: MFCD00191877 InChI Key: RTYNRTUKJVYEIE-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl acetylene,tert-butyldimethylsilylacetylene,tert-butyl ethynyl dimethylsilane,ethynyl-t-butyldimethylsilane,tert-butyldimethylsilyl ethyne,tert-butyl-ethynyl-dimethyl-silane,silane, 1,1-dimethylethyl ethynyldimethyl,t-butyldimethylsilylacetylene,tert-butyldimethylsilylethyne,tert-butylethynyldimethylsilane PubChem CID: 2757281 IUPAC Name: tert-butyl-ethynyl-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)C#C
| PubChem CID | 2757281 |
|---|---|
| CAS | 86318-61-8 |
| Molecular Weight (g/mol) | 140.301 |
| MDL Number | MFCD00191877 |
| SMILES | CC(C)(C)[Si](C)(C)C#C |
| Synonym | tert-butyldimethylsilyl acetylene,tert-butyldimethylsilylacetylene,tert-butyl ethynyl dimethylsilane,ethynyl-t-butyldimethylsilane,tert-butyldimethylsilyl ethyne,tert-butyl-ethynyl-dimethyl-silane,silane, 1,1-dimethylethyl ethynyldimethyl,t-butyldimethylsilylacetylene,tert-butyldimethylsilylethyne,tert-butylethynyldimethylsilane |
| IUPAC Name | tert-butyl-ethynyl-dimethylsilane |
| InChI Key | RTYNRTUKJVYEIE-UHFFFAOYSA-N |
| Molecular Formula | C8H16Si |
Vinyl(chloromethyl)dimethylsilane, 97%
CAS: 16709-86-7 Molecular Formula: C5H11ClSi Molecular Weight (g/mol): 134.678 MDL Number: MFCD00040860 InChI Key: SZZZMXFBEKWPBU-UHFFFAOYSA-N Synonym: chloromethyl dimethylvinylsilane,silane, chloromethyl ethenyldimethyl,vinyl chloromethyl dimethylsilane,chloromethyl ethenyldimethylsilane,ccris 2448,chloromethyldimethylvinylsilane,silane, chloromethyl dimethylvinyl,chloromethyldimethylvinyl silane,chloromethyl dimethyl vinyl silane,chloromethyl ethenyl dimethylsilane PubChem CID: 85556 IUPAC Name: chloromethyl-ethenyl-dimethylsilane SMILES: C[Si](C)(CCl)C=C
| PubChem CID | 85556 |
|---|---|
| CAS | 16709-86-7 |
| Molecular Weight (g/mol) | 134.678 |
| MDL Number | MFCD00040860 |
| SMILES | C[Si](C)(CCl)C=C |
| Synonym | chloromethyl dimethylvinylsilane,silane, chloromethyl ethenyldimethyl,vinyl chloromethyl dimethylsilane,chloromethyl ethenyldimethylsilane,ccris 2448,chloromethyldimethylvinylsilane,silane, chloromethyl dimethylvinyl,chloromethyldimethylvinyl silane,chloromethyl dimethyl vinyl silane,chloromethyl ethenyl dimethylsilane |
| IUPAC Name | chloromethyl-ethenyl-dimethylsilane |
| InChI Key | SZZZMXFBEKWPBU-UHFFFAOYSA-N |
| Molecular Formula | C5H11ClSi |
1,1,3,3-Tetramethyldisiloxane, 97%
CAS: 3277-26-7 Molecular Formula: C4H14OSi2 Molecular Weight (g/mol): 134.33 InChI Key: KWEKXPWNFQBJAY-UHFFFAOYSA-N Synonym: 1,1,3,3-tetramethyldisiloxane,tetramethyldisiloxane,dimethylsilyl ether,bis dimethylsilyl ether,bis dimethylsilyl oxide,1,3-dihydrotetramethyldisiloxane,sym-tetramethyldisiloxane,disiloxane, tetramethyl,dsstox_cid_30574,dsstox_gsid_52010 PubChem CID: 6327482 IUPAC Name: dimethylsilylideneoxonio(dimethyl)silanide SMILES: C[Si-](C)[O+]=[Si](C)C
| PubChem CID | 6327482 |
|---|---|
| CAS | 3277-26-7 |
| Molecular Weight (g/mol) | 134.33 |
| SMILES | C[Si-](C)[O+]=[Si](C)C |
| Synonym | 1,1,3,3-tetramethyldisiloxane,tetramethyldisiloxane,dimethylsilyl ether,bis dimethylsilyl ether,bis dimethylsilyl oxide,1,3-dihydrotetramethyldisiloxane,sym-tetramethyldisiloxane,disiloxane, tetramethyl,dsstox_cid_30574,dsstox_gsid_52010 |
| IUPAC Name | dimethylsilylideneoxonio(dimethyl)silanide |
| InChI Key | KWEKXPWNFQBJAY-UHFFFAOYSA-N |
| Molecular Formula | C4H14OSi2 |
N-(Trimethylsilyl)diethylamine, 97%
CAS: 996-50-9 Molecular Formula: C7H19NSi Molecular Weight (g/mol): 145.32 MDL Number: MFCD00009040 InChI Key: JOOMLFKONHCLCJ-UHFFFAOYSA-N Synonym: n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine PubChem CID: 70454 ChEBI: CHEBI:85070 IUPAC Name: N-ethyl-N-trimethylsilylethanamine SMILES: CCN(CC)[Si](C)(C)C
| PubChem CID | 70454 |
|---|---|
| CAS | 996-50-9 |
| Molecular Weight (g/mol) | 145.32 |
| ChEBI | CHEBI:85070 |
| MDL Number | MFCD00009040 |
| SMILES | CCN(CC)[Si](C)(C)C |
| Synonym | n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine |
| IUPAC Name | N-ethyl-N-trimethylsilylethanamine |
| InChI Key | JOOMLFKONHCLCJ-UHFFFAOYSA-N |
| Molecular Formula | C7H19NSi |
| Name Note | Both ends open |
|---|---|
| Chemical Name or Material | Al-23 Tube |
| TSCA | U |
| Recommended Storage | Ambient temperatures |
Gold nanoparticles, 60nm, amine-functionalized, 3kDa PEGylated, OD50, 540nm absorption, Thermo Scientific™
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
Tungsten carbide, 99.5% (metals basis)
CAS: 12070-13-2 Molecular Formula: CW2 Molecular Weight (g/mol): 379.69 MDL Number: MFCD00801036 InChI Key: FHLFYDOXSZQEPO-UHFFFAOYSA-N Synonym: tungsten carbide w2c,methyliumylidyneditungstenene PubChem CID: 102601578 IUPAC Name: methyliumylidyneditungstenene SMILES: [W-]=[W]#[C+]
| PubChem CID | 102601578 |
|---|---|
| CAS | 12070-13-2 |
| Molecular Weight (g/mol) | 379.69 |
| MDL Number | MFCD00801036 |
| SMILES | [W-]=[W]#[C+] |
| Synonym | tungsten carbide w2c,methyliumylidyneditungstenene |
| IUPAC Name | methyliumylidyneditungstenene |
| InChI Key | FHLFYDOXSZQEPO-UHFFFAOYSA-N |
| Molecular Formula | CW2 |
Copper(II) hexafluoro-2,4-pentanedionate hydrate, 99.99% (metals basis)
CAS: 155640-85-0 Molecular Formula: C10H2CuF12O4 Molecular Weight (g/mol): 477.65 MDL Number: MFCD00151019 InChI Key: HZXGNBMOOYOYIS-PAMPIZDHSA-L Synonym: copper ii hexafluoroacetylacetonate hydrate,bis hexafluoroacetylacetonato copper ii hydrate,copper ii hexafluoro-2,4-pentanedionate hydrate,copper hexafluoroacetylacetonate hydrate,copper ii hexafluoroacetyl-acetonate hydrate,hexafluoroacetylacetonato copper ii hydrate,copper ii hexafluoroacetylacetonate hydrate, elec. gr.,bis 1,1,1,5,5,5-hexafluoroacetylacetonato copper ii hydrate,copper ii 1,1,1,5,5,5-hexafluoro-2,4-pentanedionate hydrate,3z-1,1,1,5,5,5-hexafluoro-4-2z-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-yl oxy cuprio oxy pent-3-en-2-one hydrate PubChem CID: 56845342 SMILES: [Cu++].[O-]\C(=C/C(=O)C(F)(F)F)C(F)(F)F.[O-]\C(=C/C(=O)C(F)(F)F)C(F)(F)F
| PubChem CID | 56845342 |
|---|---|
| CAS | 155640-85-0 |
| Molecular Weight (g/mol) | 477.65 |
| MDL Number | MFCD00151019 |
| SMILES | [Cu++].[O-]\C(=C/C(=O)C(F)(F)F)C(F)(F)F.[O-]\C(=C/C(=O)C(F)(F)F)C(F)(F)F |
| Synonym | copper ii hexafluoroacetylacetonate hydrate,bis hexafluoroacetylacetonato copper ii hydrate,copper ii hexafluoro-2,4-pentanedionate hydrate,copper hexafluoroacetylacetonate hydrate,copper ii hexafluoroacetyl-acetonate hydrate,hexafluoroacetylacetonato copper ii hydrate,copper ii hexafluoroacetylacetonate hydrate, elec. gr.,bis 1,1,1,5,5,5-hexafluoroacetylacetonato copper ii hydrate,copper ii 1,1,1,5,5,5-hexafluoro-2,4-pentanedionate hydrate,3z-1,1,1,5,5,5-hexafluoro-4-2z-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-yl oxy cuprio oxy pent-3-en-2-one hydrate |
| InChI Key | HZXGNBMOOYOYIS-PAMPIZDHSA-L |
| Molecular Formula | C10H2CuF12O4 |